C23H34O2 — CID 90135247
(1R,2R,3aS,6aS)-5-(5-methoxypentyl)-1-[(E)-2-(4-methylphenyl)ethenyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol (PubChem CID 90135247) has the molecular formula C23H34O2 and a molecular weight of 342.52 g/mol. Its IUPAC name is (1R,2R,3aS,6aS)-5-(5-methoxypentyl)-1-[(E)-2-(4-methylphenyl)ethenyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol.
| Compound Name | (1R,2R,3aS,6aS)-5-(5-methoxypentyl)-1-[(E)-2-(4-methylphenyl)ethenyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol |
|---|---|
| PubChem CID | 90135247 |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | (1R,2R,3aS,6aS)-5-(5-methoxypentyl)-1-[(E)-2-(4-methylphenyl)ethenyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol |
| SMILES | COCCCCCC1C[C@H]2C[C@@H](O)[C@H](/C=C/c3ccc(C)cc3)[C@H]2C1 |
| InChI | InChI=1S/C23H34O2/c1-17-7-9-18(10-8-17)11-12-21-22-15-19(6-4-3-5-13-25-2)14-20(22)16-23(21)24/h7-12,19-24H,3-6,13-16H2,1-2H3/b12-11+/t19?,20-,21+,22-,23+/m0/s1 |
| InChIKey | ODOUMZHIZSZOQO-VBUFGGTMSA-N |
| XLogP | 5.24 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|