C25H42O3 — CID 90135254
5-[(3aS,5R,6R,6aS)-6-[(E)-dodec-1-enyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoic acid (PubChem CID 90135254) has the molecular formula C25H42O3 and a molecular weight of 390.61 g/mol. Its IUPAC name is 5-[(3aS,5R,6R,6aS)-6-[(E)-dodec-1-enyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoic acid.
| Compound Name | 5-[(3aS,5R,6R,6aS)-6-[(E)-dodec-1-enyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 90135254 |
| Molecular Formula | C25H42O3 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | 5-[(3aS,5R,6R,6aS)-6-[(E)-dodec-1-enyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoic acid |
| SMILES | CCCCCCCCCC/C=C/[C@@H]1[C@H]2CC(CCCCC(=O)O)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C25H42O3/c1-2-3-4-5-6-7-8-9-10-11-15-22-23-18-20(14-12-13-16-25(27)28)17-21(23)19-24(22)26/h11,15,17,21-24,26H,2-10,12-14,16,18-19H2,1H3,(H,27,28)/b15-11+/t21-,22+,23-,24+/m0/s1 |
| InChIKey | YTZXNGWTKVXFTM-IAIWUFAZSA-N |
| XLogP | 6.66 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|