About 6-chloro-7-methoxy-2,3-dimethylimidazo[1,2-b]pyridazine
6-chloro-7-methoxy-2,3-dimethylimidazo[1,2-b]pyridazine (PubChem CID 90135351) has the molecular formula C9H10ClN3O
and a molecular weight of 211.65 g/mol. Its IUPAC name is 6-chloro-7-methoxy-2,3-dimethylimidazo[1,2-b]pyridazine.
Molecular Properties
| Compound Name | 6-chloro-7-methoxy-2,3-dimethylimidazo[1,2-b]pyridazine |
| PubChem CID | 90135351 |
| Molecular Formula | C9H10ClN3O |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | 6-chloro-7-methoxy-2,3-dimethylimidazo[1,2-b]pyridazine |
| SMILES | COc1cc2nc(C)c(C)n2nc1Cl |
| InChI | InChI=1S/C9H10ClN3O/c1-5-6(2)13-8(11-5)4-7(14-3)9(10)12-13/h4H,1-3H3 |
| InChIKey | YTHKOCVKGMYNSY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-chloro-7-methoxy-2,3-dimethylimidazo[1,2-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-7-methoxy-2,3-dimethylimidazo[1,2-b]pyridazine?
The IUPAC name of 6-chloro-7-methoxy-2,3-dimethylimidazo[1,2-b]pyridazine (CID 90135351) is 6-chloro-7-methoxy-2,3-dimethylimidazo[1,2-b]pyridazine.
What is the SMILES notation for 6-chloro-7-methoxy-2,3-dimethylimidazo[1,2-b]pyridazine?
The canonical SMILES for 6-chloro-7-methoxy-2,3-dimethylimidazo[1,2-b]pyridazine is COc1cc2nc(C)c(C)n2nc1Cl.
What is the InChIKey of 6-chloro-7-methoxy-2,3-dimethylimidazo[1,2-b]pyridazine?
The InChIKey is YTHKOCVKGMYNSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClN3O/c1-5-6(2)13-8(11-5)4-7(14-3)9(10)12-13/h4H,1-3H3.
What are the key properties of 6-chloro-7-methoxy-2,3-dimethylimidazo[1,2-b]pyridazine?
6-chloro-7-methoxy-2,3-dimethylimidazo[1,2-b]pyridazine has a molecular weight of 211.65 g/mol, XLogP of 2.01, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-7-methoxy-2,3-dimethylimidazo[1,2-b]pyridazine is sourced from PubChem (CID 90135351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).