C20H15F5N2O3 — CID 90135448
(2,3,4,5,6-pentafluorophenyl) 4-(3-tert-butyl-5-oxo-4H-pyrazol-1-yl)benzoate (PubChem CID 90135448) has the molecular formula C20H15F5N2O3 and a molecular weight of 426.34 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 4-(3-tert-butyl-5-oxo-4H-pyrazol-1-yl)benzoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 4-(3-tert-butyl-5-oxo-4H-pyrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 90135448 |
| Molecular Formula | C20H15F5N2O3 |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 4-(3-tert-butyl-5-oxo-4H-pyrazol-1-yl)benzoate |
| SMILES | CC(C)(C)C1=NN(c2ccc(C(=O)Oc3c(F)c(F)c(F)c(F)c3F)cc2)C(=O)C1 |
| InChI | InChI=1S/C20H15F5N2O3/c1-20(2,3)11-8-12(28)27(26-11)10-6-4-9(5-7-10)19(29)30-18-16(24)14(22)13(21)15(23)17(18)25/h4-7H,8H2,1-3H3 |
| InChIKey | YWIGEFPMJYOHGQ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|