About 2-methoxy-3-(3-methyl-1,2-dihydrotriazol-5-yl)aniline
2-methoxy-3-(3-methyl-1,2-dihydrotriazol-5-yl)aniline (PubChem CID 90135502) has the molecular formula C10H14N4O
and a molecular weight of 206.25 g/mol. Its IUPAC name is 2-methoxy-3-(3-methyl-1,2-dihydrotriazol-5-yl)aniline.
Molecular Properties
| Compound Name | 2-methoxy-3-(3-methyl-1,2-dihydrotriazol-5-yl)aniline |
| PubChem CID | 90135502 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 2-methoxy-3-(3-methyl-1,2-dihydrotriazol-5-yl)aniline |
| SMILES | COc1c(N)cccc1C1=CN(C)NN1 |
| InChI | InChI=1S/C10H14N4O/c1-14-6-9(12-13-14)7-4-3-5-8(11)10(7)15-2/h3-6,12-13H,11H2,1-2H3 |
| InChIKey | AMVDOQRPYTZUEG-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-3-(3-methyl-1,2-dihydrotriazol-5-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-3-(3-methyl-1,2-dihydrotriazol-5-yl)aniline?
The IUPAC name of 2-methoxy-3-(3-methyl-1,2-dihydrotriazol-5-yl)aniline (CID 90135502) is 2-methoxy-3-(3-methyl-1,2-dihydrotriazol-5-yl)aniline.
What is the SMILES notation for 2-methoxy-3-(3-methyl-1,2-dihydrotriazol-5-yl)aniline?
The canonical SMILES for 2-methoxy-3-(3-methyl-1,2-dihydrotriazol-5-yl)aniline is COc1c(N)cccc1C1=CN(C)NN1.
What is the InChIKey of 2-methoxy-3-(3-methyl-1,2-dihydrotriazol-5-yl)aniline?
The InChIKey is AMVDOQRPYTZUEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4O/c1-14-6-9(12-13-14)7-4-3-5-8(11)10(7)15-2/h3-6,12-13H,11H2,1-2H3.
What are the key properties of 2-methoxy-3-(3-methyl-1,2-dihydrotriazol-5-yl)aniline?
2-methoxy-3-(3-methyl-1,2-dihydrotriazol-5-yl)aniline has a molecular weight of 206.25 g/mol, XLogP of 0.53, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-3-(3-methyl-1,2-dihydrotriazol-5-yl)aniline is sourced from PubChem (CID 90135502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).