C8H11FO4 — CID 90136240
(3aR,5R,6S,6aS)-6-fluoro-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-5-carbaldehyde (PubChem CID 90136240) has the molecular formula C8H11FO4 and a molecular weight of 190.17 g/mol. Its IUPAC name is (3aR,5R,6S,6aS)-6-fluoro-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-5-carbaldehyde.
| Compound Name | (3aR,5R,6S,6aS)-6-fluoro-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-5-carbaldehyde |
|---|---|
| PubChem CID | 90136240 |
| Molecular Formula | C8H11FO4 |
| Molecular Weight | 190.17 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | (3aR,5R,6S,6aS)-6-fluoro-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-5-carbaldehyde |
| SMILES | CC1(C)O[C@H]2O[C@H](C=O)[C@H](F)[C@H]2O1 |
| InChI | InChI=1S/C8H11FO4/c1-8(2)12-6-5(9)4(3-10)11-7(6)13-8/h3-7H,1-2H3/t4-,5+,6-,7-/m1/s1 |
| InChIKey | YMYWHCUMGSTCLF-XZBKPIIZSA-N |
| XLogP | 0.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.17 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|