C23H24N6O3 — CID 90136278
5-amino-1-(1-cyanopiperidin-3-yl)-3-[4-(3-methoxyphenoxy)phenyl]pyrazole-4-carboxamide (PubChem CID 90136278) has the molecular formula C23H24N6O3 and a molecular weight of 432.48 g/mol. Its IUPAC name is 5-amino-1-(1-cyanopiperidin-3-yl)-3-[4-(3-methoxyphenoxy)phenyl]pyrazole-4-carboxamide.
| Compound Name | 5-amino-1-(1-cyanopiperidin-3-yl)-3-[4-(3-methoxyphenoxy)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 90136278 |
| Molecular Formula | C23H24N6O3 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 5-amino-1-(1-cyanopiperidin-3-yl)-3-[4-(3-methoxyphenoxy)phenyl]pyrazole-4-carboxamide |
| SMILES | COc1cccc(Oc2ccc(-c3nn(C4CCCN(C#N)C4)c(N)c3C(N)=O)cc2)c1 |
| InChI | InChI=1S/C23H24N6O3/c1-31-18-5-2-6-19(12-18)32-17-9-7-15(8-10-17)21-20(23(26)30)22(25)29(27-21)16-4-3-11-28(13-16)14-24/h2,5-10,12,16H,3-4,11,13,25H2,1H3,(H2,26,30) |
| InChIKey | SXYNQEMBWKYHNC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 132.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|