C6H10O2 — CID 90136279
(6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (PubChem CID 90136279) has the molecular formula C6H10O2 and a molecular weight of 114.14 g/mol. Its IUPAC name is (6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan.
| Compound Name | (6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 90136279 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.14 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | (6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| SMILES | C1C[C@@H]2OCCC2O1 |
| InChI | InChI=1S/C6H10O2/c1-3-7-6-2-4-8-5(1)6/h5-6H,1-4H2/t5-,6?/m0/s1 |
| InChIKey | PHXGAJLBHUUAKB-ZBHICJROSA-N |
| XLogP | 0.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.14 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |