C23H21F3N6O3 — CID 90136388
5-amino-1-(1-cyanopiperidin-3-yl)-3-[3-[4-(trifluoromethoxy)phenoxy]phenyl]pyrazole-4-carboxamide (PubChem CID 90136388) has the molecular formula C23H21F3N6O3 and a molecular weight of 486.45 g/mol. Its IUPAC name is 5-amino-1-(1-cyanopiperidin-3-yl)-3-[3-[4-(trifluoromethoxy)phenoxy]phenyl]pyrazole-4-carboxamide.
| Compound Name | 5-amino-1-(1-cyanopiperidin-3-yl)-3-[3-[4-(trifluoromethoxy)phenoxy]phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 90136388 |
| Molecular Formula | C23H21F3N6O3 |
| Molecular Weight | 486.45 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 5-amino-1-(1-cyanopiperidin-3-yl)-3-[3-[4-(trifluoromethoxy)phenoxy]phenyl]pyrazole-4-carboxamide |
| SMILES | N#CN1CCCC(n2nc(-c3cccc(Oc4ccc(OC(F)(F)F)cc4)c3)c(C(N)=O)c2N)C1 |
| InChI | InChI=1S/C23H21F3N6O3/c24-23(25,26)35-17-8-6-16(7-9-17)34-18-5-1-3-14(11-18)20-19(22(29)33)21(28)32(30-20)15-4-2-10-31(12-15)13-27/h1,3,5-9,11,15H,2,4,10,12,28H2,(H2,29,33) |
| InChIKey | SUIRPKBRRBJRET-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 132.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|