C22H36O3 — CID 90136807
(3S,5S,7R)-7-ethyl-5-[(1E,3E)-3-methyl-5-[(2S,3S,5R,6R)-3,5,6-trimethyloxan-2-yl]penta-1,3-dienyl]-1,6-dioxaspiro[2.5]octane (PubChem CID 90136807) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is (3S,5S,7R)-7-ethyl-5-[(1E,3E)-3-methyl-5-[(2S,3S,5R,6R)-3,5,6-trimethyloxan-2-yl]penta-1,3-dienyl]-1,6-dioxaspiro[2.5]octane.
| Compound Name | (3S,5S,7R)-7-ethyl-5-[(1E,3E)-3-methyl-5-[(2S,3S,5R,6R)-3,5,6-trimethyloxan-2-yl]penta-1,3-dienyl]-1,6-dioxaspiro[2.5]octane |
|---|---|
| PubChem CID | 90136807 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | (3S,5S,7R)-7-ethyl-5-[(1E,3E)-3-methyl-5-[(2S,3S,5R,6R)-3,5,6-trimethyloxan-2-yl]penta-1,3-dienyl]-1,6-dioxaspiro[2.5]octane |
| SMILES | CC[C@@H]1C[C@@]2(CO2)C[C@@H](/C=C/C(C)=C/C[C@@H]2O[C@H](C)[C@H](C)C[C@@H]2C)O1 |
| InChI | InChI=1S/C22H36O3/c1-6-19-12-22(14-23-22)13-20(25-19)9-7-15(2)8-10-21-17(4)11-16(3)18(5)24-21/h7-9,16-21H,6,10-14H2,1-5H3/b9-7+,15-8+/t16-,17+,18-,19-,20-,21+,22+/m1/s1 |
| InChIKey | ZEQWLDFOMKYMCB-RFVVESMOSA-N |
| XLogP | 5.06 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|