C13H20O5 — CID 90136818
ethyl (3aS,4S,7R,7aS)-4-hydroxy-2,2,7-trimethyl-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate (PubChem CID 90136818) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is ethyl (3aS,4S,7R,7aS)-4-hydroxy-2,2,7-trimethyl-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate.
| Compound Name | ethyl (3aS,4S,7R,7aS)-4-hydroxy-2,2,7-trimethyl-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate |
|---|---|
| PubChem CID | 90136818 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | ethyl (3aS,4S,7R,7aS)-4-hydroxy-2,2,7-trimethyl-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate |
| SMILES | CCOC(=O)[C@]1(O)C=C[C@@H](C)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C13H20O5/c1-5-16-11(14)13(15)7-6-8(2)9-10(13)18-12(3,4)17-9/h6-10,15H,5H2,1-4H3/t8-,9+,10+,13+/m1/s1 |
| InChIKey | FKYBYCRTPMZJBF-QYTUQVAYSA-N |
| XLogP | 1.01 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|