About 1-[(Z)-prop-1-enyl]-2,3-dihydropyridin-6-imine
1-[(Z)-prop-1-enyl]-2,3-dihydropyridin-6-imine (PubChem CID 90136917) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is 1-[(Z)-prop-1-enyl]-2,3-dihydropyridin-6-imine.
Molecular Properties
| Compound Name | 1-[(Z)-prop-1-enyl]-2,3-dihydropyridin-6-imine |
| PubChem CID | 90136917 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 1-[(Z)-prop-1-enyl]-2,3-dihydropyridin-6-imine |
| SMILES | [H]/N=C1\C=CCCN1/C=C\C |
| InChI | InChI=1S/C8H12N2/c1-2-6-10-7-4-3-5-8(10)9/h2-3,5-6,9H,4,7H2,1H3/b6-2-,9-8+ |
| InChIKey | VXVHPOXDYKQBCR-OEJTVPJWSA-N |
| XLogP | 1.76 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(Z)-prop-1-enyl]-2,3-dihydropyridin-6-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z)-prop-1-enyl]-2,3-dihydropyridin-6-imine?
The IUPAC name of 1-[(Z)-prop-1-enyl]-2,3-dihydropyridin-6-imine (CID 90136917) is 1-[(Z)-prop-1-enyl]-2,3-dihydropyridin-6-imine.
What is the SMILES notation for 1-[(Z)-prop-1-enyl]-2,3-dihydropyridin-6-imine?
The canonical SMILES for 1-[(Z)-prop-1-enyl]-2,3-dihydropyridin-6-imine is [H]/N=C1\C=CCCN1/C=C\C.
What is the InChIKey of 1-[(Z)-prop-1-enyl]-2,3-dihydropyridin-6-imine?
The InChIKey is VXVHPOXDYKQBCR-OEJTVPJWSA-N. The full InChI is InChI=1S/C8H12N2/c1-2-6-10-7-4-3-5-8(10)9/h2-3,5-6,9H,4,7H2,1H3/b6-2-,9-8+.
What are the key properties of 1-[(Z)-prop-1-enyl]-2,3-dihydropyridin-6-imine?
1-[(Z)-prop-1-enyl]-2,3-dihydropyridin-6-imine has a molecular weight of 136.20 g/mol, XLogP of 1.76, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z)-prop-1-enyl]-2,3-dihydropyridin-6-imine is sourced from PubChem (CID 90136917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).