C10H14N2 — CID 90137186
3,4,7,8-tetrahydroquinolin-4-ylmethanamine (PubChem CID 90137186) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 3,4,7,8-tetrahydroquinolin-4-ylmethanamine.
| Compound Name | 3,4,7,8-tetrahydroquinolin-4-ylmethanamine |
|---|---|
| PubChem CID | 90137186 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 3,4,7,8-tetrahydroquinolin-4-ylmethanamine |
| SMILES | NCC1CC=NC2=C1C=CCC2 |
| InChI | InChI=1S/C10H14N2/c11-7-8-5-6-12-10-4-2-1-3-9(8)10/h1,3,6,8H,2,4-5,7,11H2 |
| InChIKey | RYORYSCTLDWYHJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |