About 4,7-bis(2-trimethylsilylethynyl)spiro[3H-indene-2,1'-cyclopentane]-1-one
4,7-bis(2-trimethylsilylethynyl)spiro[3H-indene-2,1'-cyclopentane]-1-one (PubChem CID 90137279) has the molecular formula C23H30OSi2
and a molecular weight of 378.66 g/mol. Its IUPAC name is 4,7-bis(2-trimethylsilylethynyl)spiro[3H-indene-2,1'-cyclopentane]-1-one.
Molecular Properties
| Compound Name | 4,7-bis(2-trimethylsilylethynyl)spiro[3H-indene-2,1'-cyclopentane]-1-one |
| PubChem CID | 90137279 |
| Molecular Formula | C23H30OSi2 |
| Molecular Weight | 378.66 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 4,7-bis(2-trimethylsilylethynyl)spiro[3H-indene-2,1'-cyclopentane]-1-one |
| SMILES | C[Si](C)(C)C#Cc1ccc(C#C[Si](C)(C)C)c2c1CC1(CCCC1)C2=O |
| InChI | InChI=1S/C23H30OSi2/c1-25(2,3)15-11-18-9-10-19(12-16-26(4,5)6)21-20(18)17-23(22(21)24)13-7-8-14-23/h9-10H,7-8,13-14,17H2,1-6H3 |
| InChIKey | WXJJYIHEOSCRIO-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.66 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4,7-bis(2-trimethylsilylethynyl)spiro[3H-indene-2,1'-cyclopentane]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-bis(2-trimethylsilylethynyl)spiro[3H-indene-2,1'-cyclopentane]-1-one?
The IUPAC name of 4,7-bis(2-trimethylsilylethynyl)spiro[3H-indene-2,1'-cyclopentane]-1-one (CID 90137279) is 4,7-bis(2-trimethylsilylethynyl)spiro[3H-indene-2,1'-cyclopentane]-1-one.
What is the SMILES notation for 4,7-bis(2-trimethylsilylethynyl)spiro[3H-indene-2,1'-cyclopentane]-1-one?
The canonical SMILES for 4,7-bis(2-trimethylsilylethynyl)spiro[3H-indene-2,1'-cyclopentane]-1-one is C[Si](C)(C)C#Cc1ccc(C#C[Si](C)(C)C)c2c1CC1(CCCC1)C2=O.
What is the InChIKey of 4,7-bis(2-trimethylsilylethynyl)spiro[3H-indene-2,1'-cyclopentane]-1-one?
The InChIKey is WXJJYIHEOSCRIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30OSi2/c1-25(2,3)15-11-18-9-10-19(12-16-26(4,5)6)21-20(18)17-23(22(21)24)13-7-8-14-23/h9-10H,7-8,13-14,17H2,1-6H3.
What are the key properties of 4,7-bis(2-trimethylsilylethynyl)spiro[3H-indene-2,1'-cyclopentane]-1-one?
4,7-bis(2-trimethylsilylethynyl)spiro[3H-indene-2,1'-cyclopentane]-1-one has a molecular weight of 378.66 g/mol, XLogP of 5.44, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-bis(2-trimethylsilylethynyl)spiro[3H-indene-2,1'-cyclopentane]-1-one is sourced from PubChem (CID 90137279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).