C28H42B2BrN3O6 — CID 90137426
tert-butyl (2S,4R)-2-(6-bromo-1H-benzimidazol-2-yl)-4-[[4,5,5-trimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolan-4-yl]methyl]pyrrolidine-1-carboxylate (PubChem CID 90137426) has the molecular formula C28H42B2BrN3O6 and a molecular weight of 618.19 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-(6-bromo-1H-benzimidazol-2-yl)-4-[[4,5,5-trimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolan-4-yl]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-(6-bromo-1H-benzimidazol-2-yl)-4-[[4,5,5-trimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolan-4-yl]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90137426 |
| Molecular Formula | C28H42B2BrN3O6 |
| Molecular Weight | 618.19 g/mol |
| Exact Mass | 617.24 |
| IUPAC Name | tert-butyl (2S,4R)-2-(6-bromo-1H-benzimidazol-2-yl)-4-[[4,5,5-trimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolan-4-yl]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](CC2(C)OB(B3OC(C)(C)C(C)(C)O3)OC2(C)C)C[C@H]1c1nc2ccc(Br)cc2[nH]1 |
| InChI | InChI=1S/C28H42B2BrN3O6/c1-24(2,3)36-23(35)34-16-17(13-21(34)22-32-19-12-11-18(31)14-20(19)33-22)15-28(10)27(8,9)39-30(40-28)29-37-25(4,5)26(6,7)38-29/h11-12,14,17,21H,13,15-16H2,1-10H3,(H,32,33)/t17-,21+,28?/m1/s1 |
| InChIKey | DOKQYNJVOKBNMJ-DGERBDQKSA-N |
| XLogP | 6.26 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.19 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|