C25H18N2O3S — CID 90137677
1-[(9,10-dioxoanthracen-2-yl)methylsulfanyl]-3-oxo-5,6,7,8-tetrahydro-2H-isoquinoline-4-carbonitrile (PubChem CID 90137677) has the molecular formula C25H18N2O3S and a molecular weight of 426.50 g/mol. Its IUPAC name is 1-[(9,10-dioxoanthracen-2-yl)methylsulfanyl]-3-oxo-5,6,7,8-tetrahydro-2H-isoquinoline-4-carbonitrile.
| Compound Name | 1-[(9,10-dioxoanthracen-2-yl)methylsulfanyl]-3-oxo-5,6,7,8-tetrahydro-2H-isoquinoline-4-carbonitrile |
|---|---|
| PubChem CID | 90137677 |
| Molecular Formula | C25H18N2O3S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 1-[(9,10-dioxoanthracen-2-yl)methylsulfanyl]-3-oxo-5,6,7,8-tetrahydro-2H-isoquinoline-4-carbonitrile |
| SMILES | N#Cc1c2c(c(SCc3ccc4c(c3)C(=O)c3ccccc3C4=O)[nH]c1=O)CCCC2 |
| InChI | InChI=1S/C25H18N2O3S/c26-12-21-15-5-1-4-8-19(15)25(27-24(21)30)31-13-14-9-10-18-20(11-14)23(29)17-7-3-2-6-16(17)22(18)28/h2-3,6-7,9-11H,1,4-5,8,13H2,(H,27,30) |
| InChIKey | XFESICRFLADEOJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|