C10H17NO2 — CID 90137721
(3E,5Z)-3,7-dimethoxy-5-methylhepta-1,3,5-trien-2-amine (PubChem CID 90137721) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is (3E,5Z)-3,7-dimethoxy-5-methylhepta-1,3,5-trien-2-amine.
| Compound Name | (3E,5Z)-3,7-dimethoxy-5-methylhepta-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 90137721 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (3E,5Z)-3,7-dimethoxy-5-methylhepta-1,3,5-trien-2-amine |
| SMILES | C=C(N)/C(=C\C(C)=C/COC)OC |
| InChI | InChI=1S/C10H17NO2/c1-8(5-6-12-3)7-10(13-4)9(2)11/h5,7H,2,6,11H2,1,3-4H3/b8-5-,10-7+ |
| InChIKey | SFFVYNFITALAOY-OEPUHGBTSA-N |
| XLogP | 1.58 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|