C19H16F5N3O2S2 — CID 90137898
5-[5-[(3S)-5-amino-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-3-yl]-4-fluorothiophen-2-yl]-2-fluorobenzonitrile (PubChem CID 90137898) has the molecular formula C19H16F5N3O2S2 and a molecular weight of 477.48 g/mol. Its IUPAC name is 5-[5-[(3S)-5-amino-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-3-yl]-4-fluorothiophen-2-yl]-2-fluorobenzonitrile.
| Compound Name | 5-[5-[(3S)-5-amino-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-3-yl]-4-fluorothiophen-2-yl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 90137898 |
| Molecular Formula | C19H16F5N3O2S2 |
| Molecular Weight | 477.48 g/mol |
| Exact Mass | 477.06 |
| IUPAC Name | 5-[5-[(3S)-5-amino-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-3-yl]-4-fluorothiophen-2-yl]-2-fluorobenzonitrile |
| SMILES | CC1(CC(F)(F)F)C(N)=N[C@](C)(c2sc(-c3ccc(F)c(C#N)c3)cc2F)CS1(=O)=O |
| InChI | InChI=1S/C19H16F5N3O2S2/c1-17(9-31(28,29)18(2,16(26)27-17)8-19(22,23)24)15-13(21)6-14(30-15)10-3-4-12(20)11(5-10)7-25/h3-6H,8-9H2,1-2H3,(H2,26,27)/t17-,18?/m0/s1 |
| InChIKey | NYMQCQXBRWDRNJ-ZENAZSQFSA-N |
| XLogP | 4.28 |
| TPSA | 96.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |