C20H17ClF4N4O3S2 — CID 90137912
(3S,6S)-3-[5-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-3-fluorothiophen-2-yl]-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-5-amine (PubChem CID 90137912) has the molecular formula C20H17ClF4N4O3S2 and a molecular weight of 536.96 g/mol. Its IUPAC name is (3S,6S)-3-[5-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-3-fluorothiophen-2-yl]-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-5-amine.
| Compound Name | (3S,6S)-3-[5-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-3-fluorothiophen-2-yl]-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 90137912 |
| Molecular Formula | C20H17ClF4N4O3S2 |
| Molecular Weight | 536.96 g/mol |
| Exact Mass | 536.04 |
| IUPAC Name | (3S,6S)-3-[5-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-3-fluorothiophen-2-yl]-3,6-dimethyl-1,1-dioxo-6-(2,2,2-trifluoroethyl)-2H-1,4-thiazin-5-amine |
| SMILES | C[C@]1(CC(F)(F)F)C(N)=N[C@](C)(c2sc(-c3nnc(-c4ccc(Cl)cc4)o3)cc2F)CS1(=O)=O |
| InChI | InChI=1S/C20H17ClF4N4O3S2/c1-18(9-34(30,31)19(2,17(26)27-18)8-20(23,24)25)14-12(22)7-13(33-14)16-29-28-15(32-16)10-3-5-11(21)6-4-10/h3-7H,8-9H2,1-2H3,(H2,26,27)/t18-,19-/m0/s1 |
| InChIKey | IBGJBGCEQLLKPR-OALUTQOASA-N |
| XLogP | 4.97 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.96 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |