C17H19N2O4+ — CID 90138028
(1-hydroxypyridin-1-ium-3-yl)-[(3R)-3-(4-methoxyphenoxy)pyrrolidin-1-yl]methanone (PubChem CID 90138028) has the molecular formula C17H19N2O4+ and a molecular weight of 315.35 g/mol. Its IUPAC name is (1-hydroxypyridin-1-ium-3-yl)-[(3R)-3-(4-methoxyphenoxy)pyrrolidin-1-yl]methanone.
| Compound Name | (1-hydroxypyridin-1-ium-3-yl)-[(3R)-3-(4-methoxyphenoxy)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 90138028 |
| Molecular Formula | C17H19N2O4+ |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | (1-hydroxypyridin-1-ium-3-yl)-[(3R)-3-(4-methoxyphenoxy)pyrrolidin-1-yl]methanone |
| SMILES | COc1ccc(O[C@@H]2CCN(C(=O)c3ccc[n+](O)c3)C2)cc1 |
| InChI | InChI=1S/C17H19N2O4/c1-22-14-4-6-15(7-5-14)23-16-8-10-18(12-16)17(20)13-3-2-9-19(21)11-13/h2-7,9,11,16,21H,8,10,12H2,1H3/q+1/t16-/m1/s1 |
| InChIKey | KCQFZIIYNZFDMI-MRXNPFEDSA-N |
| XLogP | 1.51 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|