C26H23FN2O — CID 90138338
(2Z,4E)-5-(2,7-dimethyl-[1]benzofuro[2,3-b]pyridin-8-yl)-2-(3-fluorophenyl)-N-methylhexa-2,4-dien-1-imine (PubChem CID 90138338) has the molecular formula C26H23FN2O and a molecular weight of 398.48 g/mol. Its IUPAC name is (2Z,4E)-5-(2,7-dimethyl-[1]benzofuro[2,3-b]pyridin-8-yl)-2-(3-fluorophenyl)-N-methylhexa-2,4-dien-1-imine.
| Compound Name | (2Z,4E)-5-(2,7-dimethyl-[1]benzofuro[2,3-b]pyridin-8-yl)-2-(3-fluorophenyl)-N-methylhexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 90138338 |
| Molecular Formula | C26H23FN2O |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | (2Z,4E)-5-(2,7-dimethyl-[1]benzofuro[2,3-b]pyridin-8-yl)-2-(3-fluorophenyl)-N-methylhexa-2,4-dien-1-imine |
| SMILES | C/N=C/C(=C\C=C(/C)c1c(C)ccc2c1oc1nc(C)ccc12)c1cccc(F)c1 |
| InChI | InChI=1S/C26H23FN2O/c1-16(8-11-20(15-28-4)19-6-5-7-21(27)14-19)24-17(2)9-12-22-23-13-10-18(3)29-26(23)30-25(22)24/h5-15H,1-4H3/b16-8+,20-11+,28-15+ |
| InChIKey | UFCHIBZUKVCEEV-ZXNHSPCJSA-N |
| XLogP | 6.92 |
| TPSA | 38.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|