C20H21ClN4O4S2 — CID 90138924
(3S)-3-[3-chloro-5-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]thiophen-2-yl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine (PubChem CID 90138924) has the molecular formula C20H21ClN4O4S2 and a molecular weight of 481.00 g/mol. Its IUPAC name is (3S)-3-[3-chloro-5-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]thiophen-2-yl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine.
| Compound Name | (3S)-3-[3-chloro-5-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]thiophen-2-yl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 90138924 |
| Molecular Formula | C20H21ClN4O4S2 |
| Molecular Weight | 481.00 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | (3S)-3-[3-chloro-5-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]thiophen-2-yl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
| SMILES | COc1ccc(-c2nnc(-c3cc(Cl)c([C@]4(C)CS(=O)(=O)C(C)(C)C(N)=N4)s3)o2)cc1 |
| InChI | InChI=1S/C20H21ClN4O4S2/c1-19(2)18(22)23-20(3,10-31(19,26)27)15-13(21)9-14(30-15)17-25-24-16(29-17)11-5-7-12(28-4)8-6-11/h5-9H,10H2,1-4H3,(H2,22,23)/t20-/m0/s1 |
| InChIKey | JUKYFIZDFKJKSL-FQEVSTJZSA-N |
| XLogP | 3.91 |
| TPSA | 120.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.00 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |