C24H40O5 — CID 90139149
(9S)-8-(4,4-dimethylpentyl)-7,9-dihydroxy-4,9-dimethoxy-8-methyl-5-(3-methylbut-2-enyl)bicyclo[3.3.1]non-3-en-2-one (PubChem CID 90139149) has the molecular formula C24H40O5 and a molecular weight of 408.58 g/mol. Its IUPAC name is (9S)-8-(4,4-dimethylpentyl)-7,9-dihydroxy-4,9-dimethoxy-8-methyl-5-(3-methylbut-2-enyl)bicyclo[3.3.1]non-3-en-2-one.
| Compound Name | (9S)-8-(4,4-dimethylpentyl)-7,9-dihydroxy-4,9-dimethoxy-8-methyl-5-(3-methylbut-2-enyl)bicyclo[3.3.1]non-3-en-2-one |
|---|---|
| PubChem CID | 90139149 |
| Molecular Formula | C24H40O5 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | (9S)-8-(4,4-dimethylpentyl)-7,9-dihydroxy-4,9-dimethoxy-8-methyl-5-(3-methylbut-2-enyl)bicyclo[3.3.1]non-3-en-2-one |
| SMILES | COC1=CC(=O)C2C(C)(CCCC(C)(C)C)C(O)CC1(CC=C(C)C)[C@@]2(O)OC |
| InChI | InChI=1S/C24H40O5/c1-16(2)10-13-23-15-18(26)22(6,12-9-11-21(3,4)5)20(24(23,27)29-8)17(25)14-19(23)28-7/h10,14,18,20,26-27H,9,11-13,15H2,1-8H3/t18?,20?,22?,23?,24-/m0/s1 |
| InChIKey | KECJPAJNAJPBNQ-RZOANMOCSA-N |
| XLogP | 4.38 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|