C17H11NO — CID 90139282
6-phenyl-[1]benzofuro[2,3-b]pyridine (PubChem CID 90139282) has the molecular formula C17H11NO and a molecular weight of 245.28 g/mol. Its IUPAC name is 6-phenyl-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 6-phenyl-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 90139282 |
| Molecular Formula | C17H11NO |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 6-phenyl-[1]benzofuro[2,3-b]pyridine |
| SMILES | c1ccc(-c2ccc3oc4ncccc4c3c2)cc1 |
| InChI | InChI=1S/C17H11NO/c1-2-5-12(6-3-1)13-8-9-16-15(11-13)14-7-4-10-18-17(14)19-16/h1-11H |
| InChIKey | CCTSUTSORSWCNC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |