C17H28O2 — CID 90139689
4-[(7R,8S)-3,3,4,7-tetramethyl-4,4a,5,6,7,8-hexahydroisochromen-8-yl]butan-2-one (PubChem CID 90139689) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is 4-[(7R,8S)-3,3,4,7-tetramethyl-4,4a,5,6,7,8-hexahydroisochromen-8-yl]butan-2-one.
| Compound Name | 4-[(7R,8S)-3,3,4,7-tetramethyl-4,4a,5,6,7,8-hexahydroisochromen-8-yl]butan-2-one |
|---|---|
| PubChem CID | 90139689 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 4-[(7R,8S)-3,3,4,7-tetramethyl-4,4a,5,6,7,8-hexahydroisochromen-8-yl]butan-2-one |
| SMILES | CC(=O)CC[C@@H]1C2=COC(C)(C)C(C)C2CC[C@H]1C |
| InChI | InChI=1S/C17H28O2/c1-11-6-8-15-13(3)17(4,5)19-10-16(15)14(11)9-7-12(2)18/h10-11,13-15H,6-9H2,1-5H3/t11-,13?,14+,15?/m1/s1 |
| InChIKey | ZCJYFIBBZKMAAK-CMAYJEJSSA-N |
| XLogP | 4.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |