C25H46O2Si — CID 90139691
[(7R,8S)-8-[(E)-but-2-enyl]-3,4,7-trimethyl-4,4a,5,6,7,8-hexahydroisochromen-3-yl]oxy-tri(propan-2-yl)silane (PubChem CID 90139691) has the molecular formula C25H46O2Si and a molecular weight of 406.73 g/mol. Its IUPAC name is [(7R,8S)-8-[(E)-but-2-enyl]-3,4,7-trimethyl-4,4a,5,6,7,8-hexahydroisochromen-3-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(7R,8S)-8-[(E)-but-2-enyl]-3,4,7-trimethyl-4,4a,5,6,7,8-hexahydroisochromen-3-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 90139691 |
| Molecular Formula | C25H46O2Si |
| Molecular Weight | 406.73 g/mol |
| Exact Mass | 406.33 |
| IUPAC Name | [(7R,8S)-8-[(E)-but-2-enyl]-3,4,7-trimethyl-4,4a,5,6,7,8-hexahydroisochromen-3-yl]oxy-tri(propan-2-yl)silane |
| SMILES | C/C=C/C[C@@H]1C2=COC(C)(O[Si](C(C)C)(C(C)C)C(C)C)C(C)C2CC[C@H]1C |
| InChI | InChI=1S/C25H46O2Si/c1-11-12-13-22-20(8)14-15-23-21(9)25(10,26-16-24(22)23)27-28(17(2)3,18(4)5)19(6)7/h11-12,16-23H,13-15H2,1-10H3/b12-11+/t20-,21?,22+,23?,25?/m1/s1 |
| InChIKey | MUGTYIGXVPBFKV-GIXTYORISA-N |
| XLogP | 8.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.73 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|