C7H12O3 — CID 90140604
(3S,3aR,6aS)-3-methoxy-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]furan (PubChem CID 90140604) has the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. Its IUPAC name is (3S,3aR,6aS)-3-methoxy-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]furan.
| Compound Name | (3S,3aR,6aS)-3-methoxy-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]furan |
|---|---|
| PubChem CID | 90140604 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | (3S,3aR,6aS)-3-methoxy-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]furan |
| SMILES | CO[C@@H]1CO[C@@H]2COC[C@H]12 |
| InChI | InChI=1S/C7H12O3/c1-8-6-4-10-7-3-9-2-5(6)7/h5-7H,2-4H2,1H3/t5-,6-,7-/m1/s1 |
| InChIKey | QLQHEUSMDJHEJF-FSDSQADBSA-N |
| XLogP | 0.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |