C7H11FO3 — CID 90140712
(3R,3aR,6S,6aS)-6-fluoro-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (PubChem CID 90140712) has the molecular formula C7H11FO3 and a molecular weight of 162.16 g/mol. Its IUPAC name is (3R,3aR,6S,6aS)-6-fluoro-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan.
| Compound Name | (3R,3aR,6S,6aS)-6-fluoro-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 90140712 |
| Molecular Formula | C7H11FO3 |
| Molecular Weight | 162.16 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | (3R,3aR,6S,6aS)-6-fluoro-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| SMILES | CO[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2F |
| InChI | InChI=1S/C7H11FO3/c1-9-5-3-11-6-4(8)2-10-7(5)6/h4-7H,2-3H2,1H3/t4-,5+,6+,7+/m0/s1 |
| InChIKey | IYXDYHHWHUJAAI-BDVNFPICSA-N |
| XLogP | 0.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.16 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |