C13H14IN5O — CID 90140847
2-[5-iodo-2-(methylamino)pyrimidin-4-yl]-1-methyl-6,7-dihydro-5H-pyrrolo[3,2-c]pyridin-4-one (PubChem CID 90140847) has the molecular formula C13H14IN5O and a molecular weight of 383.19 g/mol. Its IUPAC name is 2-[5-iodo-2-(methylamino)pyrimidin-4-yl]-1-methyl-6,7-dihydro-5H-pyrrolo[3,2-c]pyridin-4-one.
| Compound Name | 2-[5-iodo-2-(methylamino)pyrimidin-4-yl]-1-methyl-6,7-dihydro-5H-pyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 90140847 |
| Molecular Formula | C13H14IN5O |
| Molecular Weight | 383.19 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | 2-[5-iodo-2-(methylamino)pyrimidin-4-yl]-1-methyl-6,7-dihydro-5H-pyrrolo[3,2-c]pyridin-4-one |
| SMILES | CNc1ncc(I)c(-c2cc3c(n2C)CCNC3=O)n1 |
| InChI | InChI=1S/C13H14IN5O/c1-15-13-17-6-8(14)11(18-13)10-5-7-9(19(10)2)3-4-16-12(7)20/h5-6H,3-4H2,1-2H3,(H,16,20)(H,15,17,18) |
| InChIKey | GOVFLDUHBVSWJV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.19 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|