C15H24F3N3 — CID 90140855
(3E,5Z)-1-(4-ethylpiperazin-1-yl)-7-(trifluoromethyl)octa-3,5,7-trien-4-amine (PubChem CID 90140855) has the molecular formula C15H24F3N3 and a molecular weight of 303.37 g/mol. Its IUPAC name is (3E,5Z)-1-(4-ethylpiperazin-1-yl)-7-(trifluoromethyl)octa-3,5,7-trien-4-amine.
| Compound Name | (3E,5Z)-1-(4-ethylpiperazin-1-yl)-7-(trifluoromethyl)octa-3,5,7-trien-4-amine |
|---|---|
| PubChem CID | 90140855 |
| Molecular Formula | C15H24F3N3 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | (3E,5Z)-1-(4-ethylpiperazin-1-yl)-7-(trifluoromethyl)octa-3,5,7-trien-4-amine |
| SMILES | C=C(/C=C\C(N)=C/CCN1CCN(CC)CC1)C(F)(F)F |
| InChI | InChI=1S/C15H24F3N3/c1-3-20-9-11-21(12-10-20)8-4-5-14(19)7-6-13(2)15(16,17)18/h5-7H,2-4,8-12,19H2,1H3/b7-6-,14-5+ |
| InChIKey | WNBGSFQWYHMRAO-WFRORPSUSA-N |
| XLogP | 2.53 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|