C13H23N3O3S2 — CID 90140941
1-butyl-3,5-bis(3-sulfanylpropyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 90140941) has the molecular formula C13H23N3O3S2 and a molecular weight of 333.48 g/mol. Its IUPAC name is 1-butyl-3,5-bis(3-sulfanylpropyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-butyl-3,5-bis(3-sulfanylpropyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 90140941 |
| Molecular Formula | C13H23N3O3S2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 1-butyl-3,5-bis(3-sulfanylpropyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | CCCCn1c(=O)n(CCCS)c(=O)n(CCCS)c1=O |
| InChI | InChI=1S/C13H23N3O3S2/c1-2-3-6-14-11(17)15(7-4-9-20)13(19)16(12(14)18)8-5-10-21/h20-21H,2-10H2,1H3 |
| InChIKey | INFWOTYRYFMFAD-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|