C16H14O3S — CID 90141474
5-[(2E,4E,6Z)-octa-2,4,6-trienoyl]-2-sulfanylbenzene-1,3-dicarbaldehyde (PubChem CID 90141474) has the molecular formula C16H14O3S and a molecular weight of 286.35 g/mol. Its IUPAC name is 5-[(2E,4E,6Z)-octa-2,4,6-trienoyl]-2-sulfanylbenzene-1,3-dicarbaldehyde.
| Compound Name | 5-[(2E,4E,6Z)-octa-2,4,6-trienoyl]-2-sulfanylbenzene-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 90141474 |
| Molecular Formula | C16H14O3S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 5-[(2E,4E,6Z)-octa-2,4,6-trienoyl]-2-sulfanylbenzene-1,3-dicarbaldehyde |
| SMILES | C/C=C\C=C\C=C\C(=O)c1cc(C=O)c(S)c(C=O)c1 |
| InChI | InChI=1S/C16H14O3S/c1-2-3-4-5-6-7-15(19)12-8-13(10-17)16(20)14(9-12)11-18/h2-11,20H,1H3/b3-2-,5-4+,7-6+ |
| InChIKey | ANSFYKJWMAHITH-ZQCKCTFASA-N |
| XLogP | 3.47 |
| TPSA | 51.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|