About [4-[5,6-di(propan-2-yl)-2-bicyclo[2.2.1]heptanyl]-3,5-difluorophenyl] acetate
[4-[5,6-di(propan-2-yl)-2-bicyclo[2.2.1]heptanyl]-3,5-difluorophenyl] acetate (PubChem CID 90141615) has the molecular formula C21H28F2O2
and a molecular weight of 350.45 g/mol. Its IUPAC name is [4-[5,6-di(propan-2-yl)-2-bicyclo[2.2.1]heptanyl]-3,5-difluorophenyl] acetate.
Molecular Properties
| Compound Name | [4-[5,6-di(propan-2-yl)-2-bicyclo[2.2.1]heptanyl]-3,5-difluorophenyl] acetate |
| PubChem CID | 90141615 |
| Molecular Formula | C21H28F2O2 |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | [4-[5,6-di(propan-2-yl)-2-bicyclo[2.2.1]heptanyl]-3,5-difluorophenyl] acetate |
| SMILES | CC(=O)Oc1cc(F)c(C2CC3CC2C(C(C)C)C3C(C)C)c(F)c1 |
| InChI | InChI=1S/C21H28F2O2/c1-10(2)19-13-6-15(20(19)11(3)4)16(7-13)21-17(22)8-14(9-18(21)23)25-12(5)24/h8-11,13,15-16,19-20H,6-7H2,1-5H3 |
| InChIKey | LBQOZNGTWYCVIZ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[5,6-di(propan-2-yl)-2-bicyclo[2.2.1]heptanyl]-3,5-difluorophenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[5,6-di(propan-2-yl)-2-bicyclo[2.2.1]heptanyl]-3,5-difluorophenyl] acetate?
The IUPAC name of [4-[5,6-di(propan-2-yl)-2-bicyclo[2.2.1]heptanyl]-3,5-difluorophenyl] acetate (CID 90141615) is [4-[5,6-di(propan-2-yl)-2-bicyclo[2.2.1]heptanyl]-3,5-difluorophenyl] acetate.
What is the SMILES notation for [4-[5,6-di(propan-2-yl)-2-bicyclo[2.2.1]heptanyl]-3,5-difluorophenyl] acetate?
The canonical SMILES for [4-[5,6-di(propan-2-yl)-2-bicyclo[2.2.1]heptanyl]-3,5-difluorophenyl] acetate is CC(=O)Oc1cc(F)c(C2CC3CC2C(C(C)C)C3C(C)C)c(F)c1.
What is the InChIKey of [4-[5,6-di(propan-2-yl)-2-bicyclo[2.2.1]heptanyl]-3,5-difluorophenyl] acetate?
The InChIKey is LBQOZNGTWYCVIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28F2O2/c1-10(2)19-13-6-15(20(19)11(3)4)16(7-13)21-17(22)8-14(9-18(21)23)25-12(5)24/h8-11,13,15-16,19-20H,6-7H2,1-5H3.
What are the key properties of [4-[5,6-di(propan-2-yl)-2-bicyclo[2.2.1]heptanyl]-3,5-difluorophenyl] acetate?
[4-[5,6-di(propan-2-yl)-2-bicyclo[2.2.1]heptanyl]-3,5-difluorophenyl] acetate has a molecular weight of 350.45 g/mol, XLogP of 5.56, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[5,6-di(propan-2-yl)-2-bicyclo[2.2.1]heptanyl]-3,5-difluorophenyl] acetate is sourced from PubChem (CID 90141615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).