C26H46O5 — CID 90141838
propan-2-yl (Z)-7-[(1R,2R,3R,5S)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-propan-2-yloxycyclopentyl]hept-5-enoate (PubChem CID 90141838) has the molecular formula C26H46O5 and a molecular weight of 438.65 g/mol. Its IUPAC name is propan-2-yl (Z)-7-[(1R,2R,3R,5S)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-propan-2-yloxycyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl (Z)-7-[(1R,2R,3R,5S)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-propan-2-yloxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 90141838 |
| Molecular Formula | C26H46O5 |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 438.33 |
| IUPAC Name | propan-2-yl (Z)-7-[(1R,2R,3R,5S)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-propan-2-yloxycyclopentyl]hept-5-enoate |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)OC(C)C)[C@@H](OC(C)C)C[C@H]1O |
| InChI | InChI=1S/C26H46O5/c1-6-7-10-13-21(27)16-17-22-23(25(18-24(22)28)30-19(2)3)14-11-8-9-12-15-26(29)31-20(4)5/h8,11,16-17,19-25,27-28H,6-7,9-10,12-15,18H2,1-5H3/b11-8-,17-16+/t21-,22+,23+,24+,25-/m0/s1 |
| InChIKey | UUFHALHTHUIQFF-WNOWVGKSSA-N |
| XLogP | 5.34 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|