C16H26O4 — CID 90142185
4-[(7R,8S)-3-hydroxy-3-methoxy-4,7-dimethyl-4,4a,5,6,7,8-hexahydroisochromen-8-yl]butan-2-one (PubChem CID 90142185) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is 4-[(7R,8S)-3-hydroxy-3-methoxy-4,7-dimethyl-4,4a,5,6,7,8-hexahydroisochromen-8-yl]butan-2-one.
| Compound Name | 4-[(7R,8S)-3-hydroxy-3-methoxy-4,7-dimethyl-4,4a,5,6,7,8-hexahydroisochromen-8-yl]butan-2-one |
|---|---|
| PubChem CID | 90142185 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 4-[(7R,8S)-3-hydroxy-3-methoxy-4,7-dimethyl-4,4a,5,6,7,8-hexahydroisochromen-8-yl]butan-2-one |
| SMILES | COC1(O)OC=C2C(CC[C@@H](C)[C@@H]2CCC(C)=O)C1C |
| InChI | InChI=1S/C16H26O4/c1-10-5-7-14-12(3)16(18,19-4)20-9-15(14)13(10)8-6-11(2)17/h9-10,12-14,18H,5-8H2,1-4H3/t10-,12?,13+,14?,16?/m1/s1 |
| InChIKey | PUIJRPPCXWEPSC-YPKRBBOHSA-N |
| XLogP | 2.86 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|