C5F8O4 — CID 90142189
(8Z)-2,2,4,4,6,6,8,9-octafluoro-1,3,5,7-tetraoxonine (PubChem CID 90142189) has the molecular formula C5F8O4 and a molecular weight of 276.04 g/mol. Its IUPAC name is (8Z)-2,2,4,4,6,6,8,9-octafluoro-1,3,5,7-tetraoxonine.
| Compound Name | (8Z)-2,2,4,4,6,6,8,9-octafluoro-1,3,5,7-tetraoxonine |
|---|---|
| PubChem CID | 90142189 |
| Molecular Formula | C5F8O4 |
| Molecular Weight | 276.04 g/mol |
| Exact Mass | 275.97 |
| IUPAC Name | (8Z)-2,2,4,4,6,6,8,9-octafluoro-1,3,5,7-tetraoxonine |
| SMILES | F/C1=C(\F)OC(F)(F)OC(F)(F)OC(F)(F)O1 |
| InChI | InChI=1S/C5F8O4/c6-1-2(7)15-4(10,11)17-5(12,13)16-3(8,9)14-1/b2-1- |
| InChIKey | LFKARSALRDBMPI-UPHRSURJSA-N |
| XLogP | 2.78 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.04 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |