C24H40N6O6S5 — CID 90142500
1,3-bis(3-sulfanylpropyl)-5-[3-[3-[2,4,6-trioxo-3,5-bis(3-sulfanylpropyl)-1,3,5-triazinan-1-yl]propylsulfanyl]propyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 90142500) has the molecular formula C24H40N6O6S5 and a molecular weight of 668.95 g/mol. Its IUPAC name is 1,3-bis(3-sulfanylpropyl)-5-[3-[3-[2,4,6-trioxo-3,5-bis(3-sulfanylpropyl)-1,3,5-triazinan-1-yl]propylsulfanyl]propyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3-bis(3-sulfanylpropyl)-5-[3-[3-[2,4,6-trioxo-3,5-bis(3-sulfanylpropyl)-1,3,5-triazinan-1-yl]propylsulfanyl]propyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 90142500 |
| Molecular Formula | C24H40N6O6S5 |
| Molecular Weight | 668.95 g/mol |
| Exact Mass | 668.16 |
| IUPAC Name | 1,3-bis(3-sulfanylpropyl)-5-[3-[3-[2,4,6-trioxo-3,5-bis(3-sulfanylpropyl)-1,3,5-triazinan-1-yl]propylsulfanyl]propyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1n(CCCS)c(=O)n(CCCSCCCn2c(=O)n(CCCS)c(=O)n(CCCS)c2=O)c(=O)n1CCCS |
| InChI | InChI=1S/C24H40N6O6S5/c31-19-25(7-1-13-37)21(33)29(22(34)26(19)8-2-14-38)11-5-17-41-18-6-12-30-23(35)27(9-3-15-39)20(32)28(24(30)36)10-4-16-40/h37-40H,1-18H2 |
| InChIKey | WAAOEBLNUSNPAV-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 132.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.95 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|