C28H56O8S5 — CID 90142503
[24-(hydroxymethyl)-12,24-bis(3-sulfanylpropoxymethyl)-1,10,14,22-tetraoxa-5,6,18-trithiacyclopentacos-12-yl]methanol (PubChem CID 90142503) has the molecular formula C28H56O8S5 and a molecular weight of 681.08 g/mol. Its IUPAC name is [24-(hydroxymethyl)-12,24-bis(3-sulfanylpropoxymethyl)-1,10,14,22-tetraoxa-5,6,18-trithiacyclopentacos-12-yl]methanol.
| Compound Name | [24-(hydroxymethyl)-12,24-bis(3-sulfanylpropoxymethyl)-1,10,14,22-tetraoxa-5,6,18-trithiacyclopentacos-12-yl]methanol |
|---|---|
| PubChem CID | 90142503 |
| Molecular Formula | C28H56O8S5 |
| Molecular Weight | 681.08 g/mol |
| Exact Mass | 680.26 |
| IUPAC Name | [24-(hydroxymethyl)-12,24-bis(3-sulfanylpropoxymethyl)-1,10,14,22-tetraoxa-5,6,18-trithiacyclopentacos-12-yl]methanol |
| SMILES | OCC1(COCCCS)COCCCSCCCOCC(CO)(COCCCS)COCCCSSCCCOC1 |
| InChI | InChI=1S/C28H56O8S5/c29-19-27(21-31-7-1-13-37)23-33-9-3-15-39-16-4-10-34-24-28(20-30,22-32-8-2-14-38)26-36-12-6-18-41-40-17-5-11-35-25-27/h29-30,37-38H,1-26H2 |
| InChIKey | UHCSQZNSTIZSAL-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.08 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|