C15H24O3 — CID 90143507
4-butyl-2-ethoxy-2,3,4,6,7,8-hexahydrochromen-5-one (PubChem CID 90143507) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is 4-butyl-2-ethoxy-2,3,4,6,7,8-hexahydrochromen-5-one.
| Compound Name | 4-butyl-2-ethoxy-2,3,4,6,7,8-hexahydrochromen-5-one |
|---|---|
| PubChem CID | 90143507 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 4-butyl-2-ethoxy-2,3,4,6,7,8-hexahydrochromen-5-one |
| SMILES | CCCCC1CC(OCC)OC2=C1C(=O)CCC2 |
| InChI | InChI=1S/C15H24O3/c1-3-5-7-11-10-14(17-4-2)18-13-9-6-8-12(16)15(11)13/h11,14H,3-10H2,1-2H3 |
| InChIKey | DTFLBYDJYWPLTR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |