About 5-fluoro-1,4,6-trimethyl-2-oxopyridine-3-carbonitrile
5-fluoro-1,4,6-trimethyl-2-oxopyridine-3-carbonitrile (PubChem CID 90143685) has the molecular formula C9H9FN2O
and a molecular weight of 180.18 g/mol. Its IUPAC name is 5-fluoro-1,4,6-trimethyl-2-oxopyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 5-fluoro-1,4,6-trimethyl-2-oxopyridine-3-carbonitrile |
| PubChem CID | 90143685 |
| Molecular Formula | C9H9FN2O |
| Molecular Weight | 180.18 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 5-fluoro-1,4,6-trimethyl-2-oxopyridine-3-carbonitrile |
| SMILES | Cc1c(F)c(C)n(C)c(=O)c1C#N |
| InChI | InChI=1S/C9H9FN2O/c1-5-7(4-11)9(13)12(3)6(2)8(5)10/h1-3H3 |
| InChIKey | OJWUNQFFBITCKA-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 45.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.18 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-fluoro-1,4,6-trimethyl-2-oxopyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1,4,6-trimethyl-2-oxopyridine-3-carbonitrile?
The IUPAC name of 5-fluoro-1,4,6-trimethyl-2-oxopyridine-3-carbonitrile (CID 90143685) is 5-fluoro-1,4,6-trimethyl-2-oxopyridine-3-carbonitrile.
What is the SMILES notation for 5-fluoro-1,4,6-trimethyl-2-oxopyridine-3-carbonitrile?
The canonical SMILES for 5-fluoro-1,4,6-trimethyl-2-oxopyridine-3-carbonitrile is Cc1c(F)c(C)n(C)c(=O)c1C#N.
What is the InChIKey of 5-fluoro-1,4,6-trimethyl-2-oxopyridine-3-carbonitrile?
The InChIKey is OJWUNQFFBITCKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FN2O/c1-5-7(4-11)9(13)12(3)6(2)8(5)10/h1-3H3.
What are the key properties of 5-fluoro-1,4,6-trimethyl-2-oxopyridine-3-carbonitrile?
5-fluoro-1,4,6-trimethyl-2-oxopyridine-3-carbonitrile has a molecular weight of 180.18 g/mol, XLogP of 1.01, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1,4,6-trimethyl-2-oxopyridine-3-carbonitrile is sourced from PubChem (CID 90143685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).