C58H46O12 — CID 90143826
[4-[1,2,2-tris[4-(4-methoxybenzoyl)oxyphenyl]ethyl]phenyl] 4-methoxybenzoate (PubChem CID 90143826) has the molecular formula C58H46O12 and a molecular weight of 934.99 g/mol. Its IUPAC name is [4-[1,2,2-tris[4-(4-methoxybenzoyl)oxyphenyl]ethyl]phenyl] 4-methoxybenzoate.
| Compound Name | [4-[1,2,2-tris[4-(4-methoxybenzoyl)oxyphenyl]ethyl]phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 90143826 |
| Molecular Formula | C58H46O12 |
| Molecular Weight | 934.99 g/mol |
| Exact Mass | 934.30 |
| IUPAC Name | [4-[1,2,2-tris[4-(4-methoxybenzoyl)oxyphenyl]ethyl]phenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(C(c3ccc(OC(=O)c4ccc(OC)cc4)cc3)C(c3ccc(OC(=O)c4ccc(OC)cc4)cc3)c3ccc(OC(=O)c4ccc(OC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C58H46O12/c1-63-45-21-13-41(14-22-45)55(59)67-49-29-5-37(6-30-49)53(38-7-31-50(32-8-38)68-56(60)42-15-23-46(64-2)24-16-42)54(39-9-33-51(34-10-39)69-57(61)43-17-25-47(65-3)26-18-43)40-11-35-52(36-12-40)70-58(62)44-19-27-48(66-4)28-20-44/h5-36,53-54H,1-4H3 |
| InChIKey | NIKKLFPXEDGKST-UHFFFAOYSA-N |
| XLogP | 11.56 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 934.99 |
| LogP ≤ 5 | 11.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|