About 2,6-dimethylthieno[3,2-b]thiophene-5-carboxylic acid
2,6-dimethylthieno[3,2-b]thiophene-5-carboxylic acid (PubChem CID 901441) has the molecular formula C9H8O2S2
and a molecular weight of 212.29 g/mol. Its IUPAC name is 2,6-dimethylthieno[3,2-b]thiophene-5-carboxylic acid.
Molecular Properties
| Compound Name | 2,6-dimethylthieno[3,2-b]thiophene-5-carboxylic acid |
| PubChem CID | 901441 |
| Molecular Formula | C9H8O2S2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.00 |
| IUPAC Name | 2,6-dimethylthieno[3,2-b]thiophene-5-carboxylic acid |
| SMILES | Cc1cc2sc(C(=O)O)c(C)c2s1 |
| InChI | InChI=1S/C9H8O2S2/c1-4-3-6-7(12-4)5(2)8(13-6)9(10)11/h3H,1-2H3,(H,10,11) |
| InChIKey | KULOAKQHYDHQBM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,6-dimethylthieno[3,2-b]thiophene-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethylthieno[3,2-b]thiophene-5-carboxylic acid?
The IUPAC name of 2,6-dimethylthieno[3,2-b]thiophene-5-carboxylic acid (CID 901441) is 2,6-dimethylthieno[3,2-b]thiophene-5-carboxylic acid.
What is the SMILES notation for 2,6-dimethylthieno[3,2-b]thiophene-5-carboxylic acid?
The canonical SMILES for 2,6-dimethylthieno[3,2-b]thiophene-5-carboxylic acid is Cc1cc2sc(C(=O)O)c(C)c2s1.
What is the InChIKey of 2,6-dimethylthieno[3,2-b]thiophene-5-carboxylic acid?
The InChIKey is KULOAKQHYDHQBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O2S2/c1-4-3-6-7(12-4)5(2)8(13-6)9(10)11/h3H,1-2H3,(H,10,11).
What are the key properties of 2,6-dimethylthieno[3,2-b]thiophene-5-carboxylic acid?
2,6-dimethylthieno[3,2-b]thiophene-5-carboxylic acid has a molecular weight of 212.29 g/mol, XLogP of 3.28, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethylthieno[3,2-b]thiophene-5-carboxylic acid is sourced from PubChem (CID 901441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).