2,6-dimethylthieno[3,2-b]thiophene-5-carboxylic acid

C9H8O2S2 — CID 901441

IUPAC2,6-dimethylthieno[3,2-b]thiophene-5-carboxylic acid
SMILESCc1cc2sc(C(=O)O)c(C)c2s1
InChIInChI=1S/C9H8O2S2/c1-4-3-6-7(12-4)5(2)8(13-6)9(10)11/h3H,1-2H3,(H,10,11)
InChIKeyKULOAKQHYDHQBM-UHFFFAOYSA-N
MW212.29 g/mol
LogP3.28
Rot. Bonds1

About 2,6-dimethylthieno[3,2-b]thiophene-5-carboxylic acid

2,6-dimethylthieno[3,2-b]thiophene-5-carboxylic acid (PubChem CID 901441) has the molecular formula C9H8O2S2 and a molecular weight of 212.29 g/mol. Its IUPAC name is 2,6-dimethylthieno[3,2-b]thiophene-5-carboxylic acid.

Molecular Properties

Compound Name2,6-dimethylthieno[3,2-b]thiophene-5-carboxylic acid
PubChem CID901441
Molecular FormulaC9H8O2S2
Molecular Weight212.29 g/mol
Exact Mass212.00
IUPAC Name2,6-dimethylthieno[3,2-b]thiophene-5-carboxylic acid
SMILESCc1cc2sc(C(=O)O)c(C)c2s1
InChIInChI=1S/C9H8O2S2/c1-4-3-6-7(12-4)5(2)8(13-6)9(10)11/h3H,1-2H3,(H,10,11)
InChIKeyKULOAKQHYDHQBM-UHFFFAOYSA-N
XLogP3.28
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.29
LogP ≤ 53.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2,6-dimethylthieno[3,2-b]thiophene-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,6-dimethylthieno[3,2-b]thiophene-5-carboxylic acid?
The IUPAC name of 2,6-dimethylthieno[3,2-b]thiophene-5-carboxylic acid (CID 901441) is 2,6-dimethylthieno[3,2-b]thiophene-5-carboxylic acid.
What is the SMILES notation for 2,6-dimethylthieno[3,2-b]thiophene-5-carboxylic acid?
The canonical SMILES for 2,6-dimethylthieno[3,2-b]thiophene-5-carboxylic acid is Cc1cc2sc(C(=O)O)c(C)c2s1.
What is the InChIKey of 2,6-dimethylthieno[3,2-b]thiophene-5-carboxylic acid?
The InChIKey is KULOAKQHYDHQBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O2S2/c1-4-3-6-7(12-4)5(2)8(13-6)9(10)11/h3H,1-2H3,(H,10,11).
What are the key properties of 2,6-dimethylthieno[3,2-b]thiophene-5-carboxylic acid?
2,6-dimethylthieno[3,2-b]thiophene-5-carboxylic acid has a molecular weight of 212.29 g/mol, XLogP of 3.28, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethylthieno[3,2-b]thiophene-5-carboxylic acid is sourced from PubChem (CID 901441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).