About 2-propan-2-yl-1,5-dihydro-2,4-benzodiazepine
2-propan-2-yl-1,5-dihydro-2,4-benzodiazepine (PubChem CID 90144630) has the molecular formula C12H16N2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-propan-2-yl-1,5-dihydro-2,4-benzodiazepine.
Molecular Properties
| Compound Name | 2-propan-2-yl-1,5-dihydro-2,4-benzodiazepine |
| PubChem CID | 90144630 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 2-propan-2-yl-1,5-dihydro-2,4-benzodiazepine |
| SMILES | CC(C)N1C=NCc2ccccc2C1 |
| InChI | InChI=1S/C12H16N2/c1-10(2)14-8-12-6-4-3-5-11(12)7-13-9-14/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | DIHIXNHTNQOUKX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propan-2-yl-1,5-dihydro-2,4-benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-1,5-dihydro-2,4-benzodiazepine?
The IUPAC name of 2-propan-2-yl-1,5-dihydro-2,4-benzodiazepine (CID 90144630) is 2-propan-2-yl-1,5-dihydro-2,4-benzodiazepine.
What is the SMILES notation for 2-propan-2-yl-1,5-dihydro-2,4-benzodiazepine?
The canonical SMILES for 2-propan-2-yl-1,5-dihydro-2,4-benzodiazepine is CC(C)N1C=NCc2ccccc2C1.
What is the InChIKey of 2-propan-2-yl-1,5-dihydro-2,4-benzodiazepine?
The InChIKey is DIHIXNHTNQOUKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2/c1-10(2)14-8-12-6-4-3-5-11(12)7-13-9-14/h3-6,9-10H,7-8H2,1-2H3.
What are the key properties of 2-propan-2-yl-1,5-dihydro-2,4-benzodiazepine?
2-propan-2-yl-1,5-dihydro-2,4-benzodiazepine has a molecular weight of 188.27 g/mol, XLogP of 2.44, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-1,5-dihydro-2,4-benzodiazepine is sourced from PubChem (CID 90144630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).