About 1-[(E)-2-(3-iodo-4-methylphenyl)ethenyl]-3,5-dimethylbenzene
1-[(E)-2-(3-iodo-4-methylphenyl)ethenyl]-3,5-dimethylbenzene (PubChem CID 90144983) has the molecular formula C17H17I
and a molecular weight of 348.23 g/mol. Its IUPAC name is 1-[(E)-2-(3-iodo-4-methylphenyl)ethenyl]-3,5-dimethylbenzene.
Molecular Properties
| Compound Name | 1-[(E)-2-(3-iodo-4-methylphenyl)ethenyl]-3,5-dimethylbenzene |
| PubChem CID | 90144983 |
| Molecular Formula | C17H17I |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 1-[(E)-2-(3-iodo-4-methylphenyl)ethenyl]-3,5-dimethylbenzene |
| SMILES | Cc1cc(C)cc(/C=C/c2ccc(C)c(I)c2)c1 |
| InChI | InChI=1S/C17H17I/c1-12-8-13(2)10-16(9-12)7-6-15-5-4-14(3)17(18)11-15/h4-11H,1-3H3/b7-6+ |
| InChIKey | WPFGDVDQAGMQCA-VOTSOKGWSA-N |
| XLogP | 5.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-2-(3-iodo-4-methylphenyl)ethenyl]-3,5-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-2-(3-iodo-4-methylphenyl)ethenyl]-3,5-dimethylbenzene?
The IUPAC name of 1-[(E)-2-(3-iodo-4-methylphenyl)ethenyl]-3,5-dimethylbenzene (CID 90144983) is 1-[(E)-2-(3-iodo-4-methylphenyl)ethenyl]-3,5-dimethylbenzene.
What is the SMILES notation for 1-[(E)-2-(3-iodo-4-methylphenyl)ethenyl]-3,5-dimethylbenzene?
The canonical SMILES for 1-[(E)-2-(3-iodo-4-methylphenyl)ethenyl]-3,5-dimethylbenzene is Cc1cc(C)cc(/C=C/c2ccc(C)c(I)c2)c1.
What is the InChIKey of 1-[(E)-2-(3-iodo-4-methylphenyl)ethenyl]-3,5-dimethylbenzene?
The InChIKey is WPFGDVDQAGMQCA-VOTSOKGWSA-N. The full InChI is InChI=1S/C17H17I/c1-12-8-13(2)10-16(9-12)7-6-15-5-4-14(3)17(18)11-15/h4-11H,1-3H3/b7-6+.
What are the key properties of 1-[(E)-2-(3-iodo-4-methylphenyl)ethenyl]-3,5-dimethylbenzene?
1-[(E)-2-(3-iodo-4-methylphenyl)ethenyl]-3,5-dimethylbenzene has a molecular weight of 348.23 g/mol, XLogP of 5.39, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-2-(3-iodo-4-methylphenyl)ethenyl]-3,5-dimethylbenzene is sourced from PubChem (CID 90144983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).