C20H16ClF3N4O3S — CID 90145450
1-(4-chloro-2-pyridinyl)-3-[2-phenyl-5-(2,2,2-trifluoroethylsulfamoyl)phenyl]urea (PubChem CID 90145450) has the molecular formula C20H16ClF3N4O3S and a molecular weight of 484.89 g/mol. Its IUPAC name is 1-(4-chloro-2-pyridinyl)-3-[2-phenyl-5-(2,2,2-trifluoroethylsulfamoyl)phenyl]urea.
| Compound Name | 1-(4-chloro-2-pyridinyl)-3-[2-phenyl-5-(2,2,2-trifluoroethylsulfamoyl)phenyl]urea |
|---|---|
| PubChem CID | 90145450 |
| Molecular Formula | C20H16ClF3N4O3S |
| Molecular Weight | 484.89 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | 1-(4-chloro-2-pyridinyl)-3-[2-phenyl-5-(2,2,2-trifluoroethylsulfamoyl)phenyl]urea |
| SMILES | O=C(Nc1cc(Cl)ccn1)Nc1cc(S(=O)(=O)NCC(F)(F)F)ccc1-c1ccccc1 |
| InChI | InChI=1S/C20H16ClF3N4O3S/c21-14-8-9-25-18(10-14)28-19(29)27-17-11-15(32(30,31)26-12-20(22,23)24)6-7-16(17)13-4-2-1-3-5-13/h1-11,26H,12H2,(H2,25,27,28,29) |
| InChIKey | XCUGEYBNSRQWMH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.89 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |