About tert-butyl (5S)-5-[[(3R)-3,5-dimethylmorpholin-4-yl]methyl]-2-methylpiperazine-1-carboxylate
tert-butyl (5S)-5-[[(3R)-3,5-dimethylmorpholin-4-yl]methyl]-2-methylpiperazine-1-carboxylate (PubChem CID 90145882) has the molecular formula C17H33N3O3
and a molecular weight of 327.47 g/mol. Its IUPAC name is tert-butyl (5S)-5-[[(3R)-3,5-dimethylmorpholin-4-yl]methyl]-2-methylpiperazine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (5S)-5-[[(3R)-3,5-dimethylmorpholin-4-yl]methyl]-2-methylpiperazine-1-carboxylate |
| PubChem CID | 90145882 |
| Molecular Formula | C17H33N3O3 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.25 |
| IUPAC Name | tert-butyl (5S)-5-[[(3R)-3,5-dimethylmorpholin-4-yl]methyl]-2-methylpiperazine-1-carboxylate |
| SMILES | CC1CN[C@@H](CN2C(C)COC[C@H]2C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H33N3O3/c1-12-7-18-15(8-19-13(2)10-22-11-14(19)3)9-20(12)16(21)23-17(4,5)6/h12-15,18H,7-11H2,1-6H3/t12?,13-,14?,15+/m1/s1 |
| InChIKey | FWFXRCSIHKJGJC-JYVUQVBGSA-N |
| XLogP | 1.69 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl (5S)-5-[[(3R)-3,5-dimethylmorpholin-4-yl]methyl]-2-methylpiperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (5S)-5-[[(3R)-3,5-dimethylmorpholin-4-yl]methyl]-2-methylpiperazine-1-carboxylate?
The IUPAC name of tert-butyl (5S)-5-[[(3R)-3,5-dimethylmorpholin-4-yl]methyl]-2-methylpiperazine-1-carboxylate (CID 90145882) is tert-butyl (5S)-5-[[(3R)-3,5-dimethylmorpholin-4-yl]methyl]-2-methylpiperazine-1-carboxylate.
What is the SMILES notation for tert-butyl (5S)-5-[[(3R)-3,5-dimethylmorpholin-4-yl]methyl]-2-methylpiperazine-1-carboxylate?
The canonical SMILES for tert-butyl (5S)-5-[[(3R)-3,5-dimethylmorpholin-4-yl]methyl]-2-methylpiperazine-1-carboxylate is CC1CN[C@@H](CN2C(C)COC[C@H]2C)CN1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (5S)-5-[[(3R)-3,5-dimethylmorpholin-4-yl]methyl]-2-methylpiperazine-1-carboxylate?
The InChIKey is FWFXRCSIHKJGJC-JYVUQVBGSA-N. The full InChI is InChI=1S/C17H33N3O3/c1-12-7-18-15(8-19-13(2)10-22-11-14(19)3)9-20(12)16(21)23-17(4,5)6/h12-15,18H,7-11H2,1-6H3/t12?,13-,14?,15+/m1/s1.
What are the key properties of tert-butyl (5S)-5-[[(3R)-3,5-dimethylmorpholin-4-yl]methyl]-2-methylpiperazine-1-carboxylate?
tert-butyl (5S)-5-[[(3R)-3,5-dimethylmorpholin-4-yl]methyl]-2-methylpiperazine-1-carboxylate has a molecular weight of 327.47 g/mol, XLogP of 1.69, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (5S)-5-[[(3R)-3,5-dimethylmorpholin-4-yl]methyl]-2-methylpiperazine-1-carboxylate is sourced from PubChem (CID 90145882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).