About 1-methyl-3a,7a-dihydroindazole-4,7-diamine
1-methyl-3a,7a-dihydroindazole-4,7-diamine (PubChem CID 90145931) has the molecular formula C8H12N4
and a molecular weight of 164.21 g/mol. Its IUPAC name is 1-methyl-3a,7a-dihydroindazole-4,7-diamine.
Molecular Properties
| Compound Name | 1-methyl-3a,7a-dihydroindazole-4,7-diamine |
| PubChem CID | 90145931 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 1-methyl-3a,7a-dihydroindazole-4,7-diamine |
| SMILES | CN1N=CC2C(N)=CC=C(N)C21 |
| InChI | InChI=1S/C8H12N4/c1-12-8-5(4-11-12)6(9)2-3-7(8)10/h2-5,8H,9-10H2,1H3 |
| InChIKey | DTVRNXHCHNOYJR-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methyl-3a,7a-dihydroindazole-4,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3a,7a-dihydroindazole-4,7-diamine?
The IUPAC name of 1-methyl-3a,7a-dihydroindazole-4,7-diamine (CID 90145931) is 1-methyl-3a,7a-dihydroindazole-4,7-diamine.
What is the SMILES notation for 1-methyl-3a,7a-dihydroindazole-4,7-diamine?
The canonical SMILES for 1-methyl-3a,7a-dihydroindazole-4,7-diamine is CN1N=CC2C(N)=CC=C(N)C21.
What is the InChIKey of 1-methyl-3a,7a-dihydroindazole-4,7-diamine?
The InChIKey is DTVRNXHCHNOYJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4/c1-12-8-5(4-11-12)6(9)2-3-7(8)10/h2-5,8H,9-10H2,1H3.
What are the key properties of 1-methyl-3a,7a-dihydroindazole-4,7-diamine?
1-methyl-3a,7a-dihydroindazole-4,7-diamine has a molecular weight of 164.21 g/mol, XLogP of -0.40, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3a,7a-dihydroindazole-4,7-diamine is sourced from PubChem (CID 90145931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).