C24H31NO2 — CID 90145972
(3S,5S)-1-(2,2-dimethylpropanoyl)-5-[[4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]phenyl]methyl]-3-methylpyrrolidin-2-one (PubChem CID 90145972) has the molecular formula C24H31NO2 and a molecular weight of 365.52 g/mol. Its IUPAC name is (3S,5S)-1-(2,2-dimethylpropanoyl)-5-[[4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]phenyl]methyl]-3-methylpyrrolidin-2-one.
| Compound Name | (3S,5S)-1-(2,2-dimethylpropanoyl)-5-[[4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]phenyl]methyl]-3-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 90145972 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | (3S,5S)-1-(2,2-dimethylpropanoyl)-5-[[4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]phenyl]methyl]-3-methylpyrrolidin-2-one |
| SMILES | C=C(/C=C\C=C/C)c1ccc(C[C@@H]2C[C@H](C)C(=O)N2C(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H31NO2/c1-7-8-9-10-17(2)20-13-11-19(12-14-20)16-21-15-18(3)22(26)25(21)23(27)24(4,5)6/h7-14,18,21H,2,15-16H2,1,3-6H3/b8-7-,10-9-/t18-,21-/m0/s1 |
| InChIKey | AVPJTZHXLYCBQZ-OQBVEUMKSA-N |
| XLogP | 5.18 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|