C5H12O4 — CID 90146781
(2S,3R,4S)-pentane-1,2,3,4-tetrol (PubChem CID 90146781) has the molecular formula C5H12O4 and a molecular weight of 136.15 g/mol. Its IUPAC name is (2S,3R,4S)-pentane-1,2,3,4-tetrol.
| Compound Name | (2S,3R,4S)-pentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 90146781 |
| Molecular Formula | C5H12O4 |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | (2S,3R,4S)-pentane-1,2,3,4-tetrol |
| SMILES | C[C@H](O)[C@@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C5H12O4/c1-3(7)5(9)4(8)2-6/h3-9H,2H2,1H3/t3-,4-,5+/m0/s1 |
| InChIKey | FJGNTEKSQVNVTJ-VAYJURFESA-N |
| XLogP | -1.92 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |