About (4aR)-9,9a-dihydro-4aH-carbazole
(4aR)-9,9a-dihydro-4aH-carbazole (PubChem CID 90146984) has the molecular formula C12H11N
and a molecular weight of 169.23 g/mol. Its IUPAC name is (4aR)-9,9a-dihydro-4aH-carbazole.
Molecular Properties
| Compound Name | (4aR)-9,9a-dihydro-4aH-carbazole |
| PubChem CID | 90146984 |
| Molecular Formula | C12H11N |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | (4aR)-9,9a-dihydro-4aH-carbazole |
| SMILES | C1=CC2Nc3ccccc3[C@H]2C=C1 |
| InChI | InChI=1S/C12H11N/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-9,11,13H/t9-,11?/m1/s1 |
| InChIKey | OISVIGAIEDIRNI-BFHBGLAWSA-N |
| XLogP | 2.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4aR)-9,9a-dihydro-4aH-carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4aR)-9,9a-dihydro-4aH-carbazole?
The IUPAC name of (4aR)-9,9a-dihydro-4aH-carbazole (CID 90146984) is (4aR)-9,9a-dihydro-4aH-carbazole.
What is the SMILES notation for (4aR)-9,9a-dihydro-4aH-carbazole?
The canonical SMILES for (4aR)-9,9a-dihydro-4aH-carbazole is C1=CC2Nc3ccccc3[C@H]2C=C1.
What is the InChIKey of (4aR)-9,9a-dihydro-4aH-carbazole?
The InChIKey is OISVIGAIEDIRNI-BFHBGLAWSA-N. The full InChI is InChI=1S/C12H11N/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-9,11,13H/t9-,11?/m1/s1.
What are the key properties of (4aR)-9,9a-dihydro-4aH-carbazole?
(4aR)-9,9a-dihydro-4aH-carbazole has a molecular weight of 169.23 g/mol, XLogP of 2.69, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4aR)-9,9a-dihydro-4aH-carbazole is sourced from PubChem (CID 90146984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).